C33H46N4O4 — CID 10210786
benzyl N-[4-[(3S)-2,5-dioxo-9-(4-phenylbutyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate (PubChem CID 10210786) has the molecular formula C33H46N4O4 and a molecular weight of 562.76 g/mol. Its IUPAC name is benzyl N-[4-[(3S)-2,5-dioxo-9-(4-phenylbutyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(3S)-2,5-dioxo-9-(4-phenylbutyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 10210786 |
| Molecular Formula | C33H46N4O4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | benzyl N-[4-[(3S)-2,5-dioxo-9-(4-phenylbutyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate |
| SMILES | CCCN1C(=O)[C@H](CCCCNC(=O)OCc2ccccc2)NC(=O)C12CCN(CCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C33H46N4O4/c1-2-22-37-30(38)29(18-9-11-21-34-32(40)41-26-28-16-7-4-8-17-28)35-31(39)33(37)19-24-36(25-20-33)23-12-10-15-27-13-5-3-6-14-27/h3-8,13-14,16-17,29H,2,9-12,15,18-26H2,1H3,(H,34,40)(H,35,39)/t29-/m0/s1 |
| InChIKey | VUGRMGPEWOYHQY-LJAQVGFWSA-N |
| XLogP | 4.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|