C28H40N4O6 — CID 21064372
but-3-enyl (3S)-2,5-dioxo-3-[4-(phenylmethoxycarbonylamino)butyl]-1-propyl-1,4,9-triazaspiro[5.5]undecane-9-carboxylate (PubChem CID 21064372) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is but-3-enyl (3S)-2,5-dioxo-3-[4-(phenylmethoxycarbonylamino)butyl]-1-propyl-1,4,9-triazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | but-3-enyl (3S)-2,5-dioxo-3-[4-(phenylmethoxycarbonylamino)butyl]-1-propyl-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 21064372 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | but-3-enyl (3S)-2,5-dioxo-3-[4-(phenylmethoxycarbonylamino)butyl]-1-propyl-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
| SMILES | C=CCCOC(=O)N1CCC2(CC1)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)N2CCC |
| InChI | InChI=1S/C28H40N4O6/c1-3-5-20-37-27(36)31-18-14-28(15-19-31)25(34)30-23(24(33)32(28)17-4-2)13-9-10-16-29-26(35)38-21-22-11-7-6-8-12-22/h3,6-8,11-12,23H,1,4-5,9-10,13-21H2,2H3,(H,29,35)(H,30,34)/t23-/m0/s1 |
| InChIKey | WUXOIVGPBVTGLZ-QHCPKHFHSA-N |
| XLogP | 3.37 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|