C26H39N3O4 — CID 173285947
benzyl N-[4-[(2S,9E)-4-methyl-3,15-dioxo-1,4-diazacyclopentadec-9-en-2-yl]butyl]carbamate (PubChem CID 173285947) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is benzyl N-[4-[(2S,9E)-4-methyl-3,15-dioxo-1,4-diazacyclopentadec-9-en-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(2S,9E)-4-methyl-3,15-dioxo-1,4-diazacyclopentadec-9-en-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 173285947 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | benzyl N-[4-[(2S,9E)-4-methyl-3,15-dioxo-1,4-diazacyclopentadec-9-en-2-yl]butyl]carbamate |
| SMILES | CN1CCCC/C=C/CCCCC(=O)N[C@@H](CCCCNC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H39N3O4/c1-29-20-14-7-5-3-2-4-6-11-18-24(30)28-23(25(29)31)17-12-13-19-27-26(32)33-21-22-15-9-8-10-16-22/h2-3,8-10,15-16,23H,4-7,11-14,17-21H2,1H3,(H,27,32)(H,28,30)/b3-2+/t23-/m0/s1 |
| InChIKey | JOLFFIFTCPCRRM-XFBYCMBJSA-N |
| XLogP | 4.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|