C25H28N4O4 — CID 174979847
benzyl N-[4-[(2R)-4-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]carbamate (PubChem CID 174979847) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is benzyl N-[4-[(2R)-4-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(2R)-4-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 174979847 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | benzyl N-[4-[(2R)-4-(1H-indol-3-ylmethyl)-3,6-dioxopiperazin-2-yl]butyl]carbamate |
| SMILES | O=C1CN(Cc2c[nH]c3ccccc23)C(=O)[C@@H](CCCCNC(=O)OCc2ccccc2)N1 |
| InChI | InChI=1S/C25H28N4O4/c30-23-16-29(15-19-14-27-21-11-5-4-10-20(19)21)24(31)22(28-23)12-6-7-13-26-25(32)33-17-18-8-2-1-3-9-18/h1-5,8-11,14,22,27H,6-7,12-13,15-17H2,(H,26,32)(H,28,30)/t22-/m1/s1 |
| InChIKey | VRHQZGVQGLXPRN-JOCHJYFZSA-N |
| XLogP | 3.09 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|