C31H37N3O3 — CID 26140364
1-(3-methoxypropyl)-3-(naphthalen-2-ylmethyl)-8-(3-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26140364) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(naphthalen-2-ylmethyl)-8-(3-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(3-methoxypropyl)-3-(naphthalen-2-ylmethyl)-8-(3-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26140364 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(naphthalen-2-ylmethyl)-8-(3-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(Cc2ccc3ccccc3c2)C(=O)C12CCN(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C31H37N3O3/c1-37-22-8-19-34-30(36)33(24-26-14-15-27-12-5-6-13-28(27)23-26)29(35)31(34)16-20-32(21-17-31)18-7-11-25-9-3-2-4-10-25/h2-6,9-10,12-15,23H,7-8,11,16-22,24H2,1H3 |
| InChIKey | QWXACSQYEOUPBB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|