C28H37N3O4 — CID 45162126
3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 45162126) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 45162126 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(Cc2ccc(OC)cc2)C(=O)C12CCN(CC(C)c1ccccc1)CC2 |
| InChI | InChI=1S/C28H37N3O4/c1-22(24-8-5-4-6-9-24)20-29-17-14-28(15-18-29)26(32)30(27(33)31(28)16-7-19-34-2)21-23-10-12-25(35-3)13-11-23/h4-6,8-13,22H,7,14-21H2,1-3H3 |
| InChIKey | OPKHUCPZPAOJJR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|