C29H39N3O4 — CID 45162214
3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(4-phenylbutan-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 45162214) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(4-phenylbutan-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(4-phenylbutan-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 45162214 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)-8-(4-phenylbutan-2-yl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCCN1C(=O)N(Cc2ccc(OC)cc2)C(=O)C12CCN(C(C)CCc1ccccc1)CC2 |
| InChI | InChI=1S/C29H39N3O4/c1-23(10-11-24-8-5-4-6-9-24)30-19-16-29(17-20-30)27(33)31(28(34)32(29)18-7-21-35-2)22-25-12-14-26(36-3)15-13-25/h4-6,8-9,12-15,23H,7,10-11,16-22H2,1-3H3 |
| InChIKey | ZQGHPVIWCQMSQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|