C28H38N4O3 — CID 26136451
1-ethyl-8-[(2R)-4-(4-methoxyphenyl)butan-2-yl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26136451) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-ethyl-8-[(2R)-4-(4-methoxyphenyl)butan-2-yl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-ethyl-8-[(2R)-4-(4-methoxyphenyl)butan-2-yl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26136451 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1-ethyl-8-[(2R)-4-(4-methoxyphenyl)butan-2-yl]-3-(3-pyridin-3-ylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)N(CCCc2cccnc2)C(=O)C12CCN([C@H](C)CCc1ccc(OC)cc1)CC2 |
| InChI | InChI=1S/C28H38N4O3/c1-4-32-27(34)31(18-6-8-24-7-5-17-29-21-24)26(33)28(32)15-19-30(20-16-28)22(2)9-10-23-11-13-25(35-3)14-12-23/h5,7,11-14,17,21-22H,4,6,8-10,15-16,18-20H2,1-3H3/t22-/m1/s1 |
| InChIKey | XYVLWBZHIYRIJT-JOCHJYFZSA-N |
| XLogP | 4.16 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|