C29H35N3O2 — CID 26134019
3-benzyl-8-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26134019) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-benzyl-8-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-benzyl-8-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26134019 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-benzyl-8-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-(2-phenylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1N(Cc2ccccc2)C(=O)C2(CCN(C[C@H]3CC=CCC3)CC2)N1CCc1ccccc1 |
| InChI | InChI=1S/C29H35N3O2/c33-27-29(17-20-30(21-18-29)22-25-12-6-2-7-13-25)32(19-16-24-10-4-1-5-11-24)28(34)31(27)23-26-14-8-3-9-15-26/h1-6,8-11,14-15,25H,7,12-13,16-23H2/t25-/m0/s1 |
| InChIKey | LLXNUYKTWBPVAN-VWLOTQADSA-N |
| XLogP | 4.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|