C28H41N3O4 — CID 21064089
(3R)-1-butyl-3-(cyclohexylmethyl)-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 21064089) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is (3R)-1-butyl-3-(cyclohexylmethyl)-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-3-(cyclohexylmethyl)-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 21064089 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | (3R)-1-butyl-3-(cyclohexylmethyl)-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H](CC2CCCCC2)NC(=O)C12CCN(Cc1ccc3c(c1)OCCO3)CC2 |
| InChI | InChI=1S/C28H41N3O4/c1-2-3-13-31-26(32)23(18-21-7-5-4-6-8-21)29-27(33)28(31)11-14-30(15-12-28)20-22-9-10-24-25(19-22)35-17-16-34-24/h9-10,19,21,23H,2-8,11-18,20H2,1H3,(H,29,33)/t23-/m1/s1 |
| InChIKey | VBONNDPACFTZMX-HSZRJFAPSA-N |
| XLogP | 3.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |