C25H27F3O6 — CID 11641520
[(1S,2E)-3,7-dimethyl-1-[(3S)-4-methylidene-5-oxooxolan-3-yl]-5-oxoocta-2,6-dienyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11641520) has the molecular formula C25H27F3O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is [(1S,2E)-3,7-dimethyl-1-[(3S)-4-methylidene-5-oxooxolan-3-yl]-5-oxoocta-2,6-dienyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2E)-3,7-dimethyl-1-[(3S)-4-methylidene-5-oxooxolan-3-yl]-5-oxoocta-2,6-dienyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11641520 |
| Molecular Formula | C25H27F3O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [(1S,2E)-3,7-dimethyl-1-[(3S)-4-methylidene-5-oxooxolan-3-yl]-5-oxoocta-2,6-dienyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1C(=O)OC[C@H]1[C@H](/C=C(\C)CC(=O)C=C(C)C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H27F3O6/c1-15(2)11-19(29)12-16(3)13-21(20-14-33-22(30)17(20)4)34-23(31)24(32-5,25(26,27)28)18-9-7-6-8-10-18/h6-11,13,20-21H,4,12,14H2,1-3,5H3/b16-13+/t20-,21+,24+/m1/s1 |
| InChIKey | HQDKERRWLFZLAQ-MKTYLEENSA-N |
| XLogP | 4.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|