C29H27ClFN5O3S — CID 11642720
(2S)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-4-methylsulfanyl-2-(prop-2-enoylamino)butanamide (PubChem CID 11642720) has the molecular formula C29H27ClFN5O3S and a molecular weight of 580.09 g/mol. Its IUPAC name is (2S)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-4-methylsulfanyl-2-(prop-2-enoylamino)butanamide.
| Compound Name | (2S)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-4-methylsulfanyl-2-(prop-2-enoylamino)butanamide |
|---|---|
| PubChem CID | 11642720 |
| Molecular Formula | C29H27ClFN5O3S |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | (2S)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-4-methylsulfanyl-2-(prop-2-enoylamino)butanamide |
| SMILES | C=CC(=O)N[C@@H](CCSC)C(=O)Nc1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C29H27ClFN5O3S/c1-3-27(37)36-25(11-12-40-2)29(38)35-20-7-9-24-22(14-20)28(33-17-32-24)34-21-8-10-26(23(30)15-21)39-16-18-5-4-6-19(31)13-18/h3-10,13-15,17,25H,1,11-12,16H2,2H3,(H,35,38)(H,36,37)(H,32,33,34)/t25-/m0/s1 |
| InChIKey | ROTSPILLFMKHAM-VWLOTQADSA-N |
| XLogP | 6.11 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|