C32H38N5O6PS — CID 11643174
[2-[[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-[2-phenyl-1-(thiophene-2-carbonylamino)ethyl]phosphinic acid (PubChem CID 11643174) has the molecular formula C32H38N5O6PS and a molecular weight of 651.73 g/mol. Its IUPAC name is [2-[[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-[2-phenyl-1-(thiophene-2-carbonylamino)ethyl]phosphinic acid.
| Compound Name | [2-[[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-[2-phenyl-1-(thiophene-2-carbonylamino)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 11643174 |
| Molecular Formula | C32H38N5O6PS |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | [2-[[(2S)-1-[[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-[2-phenyl-1-(thiophene-2-carbonylamino)ethyl]phosphinic acid |
| SMILES | CC(C)C[C@H](NC(=O)CP(=O)(O)C(Cc1ccccc1)NC(=O)c1cccs1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C32H38N5O6PS/c1-20(2)15-26(31(40)36-25(30(33)39)17-22-18-34-24-12-7-6-11-23(22)24)35-28(38)19-44(42,43)29(16-21-9-4-3-5-10-21)37-32(41)27-13-8-14-45-27/h3-14,18,20,25-26,29,34H,15-17,19H2,1-2H3,(H2,33,39)(H,35,38)(H,36,40)(H,37,41)(H,42,43)/t25-,26-,29?/m0/s1 |
| InChIKey | KPNFPQAPDLUAIG-QEGCZXFXSA-N |
| XLogP | 3.54 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|