C19H37NO4 — CID 11645877
N-(2,3-dihydroxypropyl)-2-hexyl-3-oxodecanamide (PubChem CID 11645877) has the molecular formula C19H37NO4 and a molecular weight of 343.51 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-hexyl-3-oxodecanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-hexyl-3-oxodecanamide |
|---|---|
| PubChem CID | 11645877 |
| Molecular Formula | C19H37NO4 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-hexyl-3-oxodecanamide |
| SMILES | CCCCCCCC(=O)C(CCCCCC)C(=O)NCC(O)CO |
| InChI | InChI=1S/C19H37NO4/c1-3-5-7-9-11-13-18(23)17(12-10-8-6-4-2)19(24)20-14-16(22)15-21/h16-17,21-22H,3-15H2,1-2H3,(H,20,24) |
| InChIKey | BJQISRPNMQCBEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|