C22H30ClN3O2 — CID 11647084
7-chloro-4-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 11647084) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is 7-chloro-4-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | 7-chloro-4-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 11647084 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 7-chloro-4-[[(2R)-1-ethylpyrrolidin-2-yl]methylamino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | CCN1CCC[C@@H]1CNC1c2cc3nc(Cl)cc(C)c3cc2OC(C)(C)C1O |
| InChI | InChI=1S/C22H30ClN3O2/c1-5-26-8-6-7-14(26)12-24-20-16-10-17-15(13(2)9-19(23)25-17)11-18(16)28-22(3,4)21(20)27/h9-11,14,20-21,24,27H,5-8,12H2,1-4H3/t14-,20?,21?/m1/s1 |
| InChIKey | BAQBVLMAIRROTP-OZJRSANCSA-N |
| XLogP | 3.84 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|