C23H40N2O6Si — CID 11648449
tert-butyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-5-nitropentan-2-yl]carbamate (PubChem CID 11648449) has the molecular formula C23H40N2O6Si and a molecular weight of 468.67 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-5-nitropentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-5-nitropentan-2-yl]carbamate |
|---|---|
| PubChem CID | 11648449 |
| Molecular Formula | C23H40N2O6Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | tert-butyl N-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-5-nitropentan-2-yl]carbamate |
| SMILES | COc1ccc(C[C@@H](C[C@H](C[N+](=O)[O-])O[Si](C)(C)C(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H40N2O6Si/c1-22(2,3)30-21(26)24-18(14-17-10-12-19(29-7)13-11-17)15-20(16-25(27)28)31-32(8,9)23(4,5)6/h10-13,18,20H,14-16H2,1-9H3,(H,24,26)/t18-,20+/m0/s1 |
| InChIKey | KOUBXSHNFKWDPG-AZUAARDMSA-N |
| XLogP | 5.19 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|