C24H21FN2O4S — CID 1164875
N-benzyl-2-fluoro-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide (PubChem CID 1164875) has the molecular formula C24H21FN2O4S and a molecular weight of 452.51 g/mol. Its IUPAC name is N-benzyl-2-fluoro-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-2-fluoro-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1164875 |
| Molecular Formula | C24H21FN2O4S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-benzyl-2-fluoro-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc2[nH]c(=O)c(CN(Cc3ccccc3)S(=O)(=O)c3ccccc3F)cc2c1 |
| InChI | InChI=1S/C24H21FN2O4S/c1-31-20-11-12-22-18(14-20)13-19(24(28)26-22)16-27(15-17-7-3-2-4-8-17)32(29,30)23-10-6-5-9-21(23)25/h2-14H,15-16H2,1H3,(H,26,28) |
| InChIKey | FROWABPOAKXUDC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |