C26H25N3O7S — CID 1165257
N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 1165257) has the molecular formula C26H25N3O7S and a molecular weight of 523.57 g/mol. Its IUPAC name is N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 1165257 |
| Molecular Formula | C26H25N3O7S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-[(4-methoxyphenyl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccc(OC)cc3)S(=O)(=O)c3ccccc3[N+](=O)[O-])cc2c1 |
| InChI | InChI=1S/C26H25N3O7S/c1-3-36-22-12-13-23-19(15-22)14-20(26(30)27-23)17-28(16-18-8-10-21(35-2)11-9-18)37(33,34)25-7-5-4-6-24(25)29(31)32/h4-15H,3,16-17H2,1-2H3,(H,27,30) |
| InChIKey | BBKLKOWYYOETEE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|