C26H23N3O9S — CID 3184178
N-(1,3-benzodioxol-5-ylmethyl)-N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-nitrobenzenesulfonamide (PubChem CID 3184178) has the molecular formula C26H23N3O9S and a molecular weight of 553.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3184178 |
| Molecular Formula | C26H23N3O9S |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-2-nitrobenzenesulfonamide |
| SMILES | COc1cc2cc(CN(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3ccccc3[N+](=O)[O-])c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C26H23N3O9S/c1-35-22-11-17-10-18(26(30)27-19(17)12-23(22)36-2)14-28(13-16-7-8-21-24(9-16)38-15-37-21)39(33,34)25-6-4-3-5-20(25)29(31)32/h3-12H,13-15H2,1-2H3,(H,27,30) |
| InChIKey | WWRHHPISBMYRND-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|