C21H23Br2NO3 — CID 11648960
tert-butyl 2-[[4-[(E)-2-(3-aminophenyl)ethenyl]-3,5-dibromophenyl]methoxy]acetate (PubChem CID 11648960) has the molecular formula C21H23Br2NO3 and a molecular weight of 497.23 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(E)-2-(3-aminophenyl)ethenyl]-3,5-dibromophenyl]methoxy]acetate.
| Compound Name | tert-butyl 2-[[4-[(E)-2-(3-aminophenyl)ethenyl]-3,5-dibromophenyl]methoxy]acetate |
|---|---|
| PubChem CID | 11648960 |
| Molecular Formula | C21H23Br2NO3 |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | tert-butyl 2-[[4-[(E)-2-(3-aminophenyl)ethenyl]-3,5-dibromophenyl]methoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCc1cc(Br)c(/C=C/c2cccc(N)c2)c(Br)c1 |
| InChI | InChI=1S/C21H23Br2NO3/c1-21(2,3)27-20(25)13-26-12-15-10-18(22)17(19(23)11-15)8-7-14-5-4-6-16(24)9-14/h4-11H,12-13,24H2,1-3H3/b8-7+ |
| InChIKey | QWBNGYDESHKAPH-BQYQJAHWSA-N |
| XLogP | 5.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|