trimethylazanium chloride

C3H10ClN — CID 11649

IUPACtrimethylazanium chloride
SMILESC[NH+](C)C.[Cl-]
InChIInChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H
InChIKeySZYJELPVAFJOGJ-UHFFFAOYSA-N
MW95.57 g/mol
LogP-4.24
Rot. Bonds

About trimethylazanium chloride

trimethylazanium chloride (PubChem CID 11649) has the molecular formula C3H10ClN and a molecular weight of 95.57 g/mol. Its IUPAC name is trimethylazanium chloride.

Molecular Properties

Compound Nametrimethylazanium chloride
PubChem CID11649
Molecular FormulaC3H10ClN
Molecular Weight95.57 g/mol
Exact Mass95.05
IUPAC Nametrimethylazanium chloride
SMILESC[NH+](C)C.[Cl-]
InChIInChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H
InChIKeySZYJELPVAFJOGJ-UHFFFAOYSA-N
XLogP-4.24
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50095.57
LogP ≤ 5-4.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze trimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Dimethylamine, hydrochloride
CID 10473
Trimethylammonium
CID 3782034
Dimethylaminium
CID 3614769
Di[(2H3)methyl]ammonium chloride
CID 12199012
Dimethylamine-15N hydrochloride
CID 16213415
Dimethylamine-13C2 hydrochloride
CID 16213551
Trimethylazanium iodide
CID 13798042
Trimethyl ammonium bromide
CID 14544808
Dimethyl ammonium chloride
CID 521289
Dimethylazanium;chloride
CID 12954980
N-Methyl(~2~H_3_)methanamine--hydrogen chloride (1/1)
CID 16213327
N-chlorotrimethylammonium chloride
CID 12698370

Frequently Asked Questions

What is the IUPAC name of trimethylazanium chloride?
The IUPAC name of trimethylazanium chloride (CID 11649) is trimethylazanium chloride.
What is the SMILES notation for trimethylazanium chloride?
The canonical SMILES for trimethylazanium chloride is C[NH+](C)C.[Cl-].
What is the InChIKey of trimethylazanium chloride?
The InChIKey is SZYJELPVAFJOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H.
What are the key properties of trimethylazanium chloride?
trimethylazanium chloride has a molecular weight of 95.57 g/mol, XLogP of -4.24, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylazanium chloride is sourced from PubChem (CID 11649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).