About trimethylazanium
trimethylazanium (PubChem CID 3782034) has the molecular formula C3H10N+
and a molecular weight of 60.12 g/mol. Its IUPAC name is trimethylazanium.
Molecular Properties
| Compound Name | trimethylazanium |
| PubChem CID | 3782034 |
| Molecular Formula | C3H10N+ |
| Molecular Weight | 60.12 g/mol |
| Exact Mass | 60.08 |
| IUPAC Name | trimethylazanium |
| SMILES | C[NH+](C)C |
| InChI | InChI=1S/C3H9N/c1-4(2)3/h1-3H3/p+1 |
| InChIKey | GETQZCLCWQTVFV-UHFFFAOYSA-O |
| XLogP | -1.24 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.12 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylazanium?
The IUPAC name of trimethylazanium (CID 3782034) is trimethylazanium.
What is the SMILES notation for trimethylazanium?
The canonical SMILES for trimethylazanium is C[NH+](C)C.
What is the InChIKey of trimethylazanium?
The InChIKey is GETQZCLCWQTVFV-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N/c1-4(2)3/h1-3H3/p+1.
What are the key properties of trimethylazanium?
trimethylazanium has a molecular weight of 60.12 g/mol, XLogP of -1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylazanium is sourced from PubChem (CID 3782034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).