About dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate
dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate (PubChem CID 116500640) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate |
| PubChem CID | 116500640 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate |
| SMILES | COCCC(C)C(C(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H26O5/c1-9(2)18-13(15)12(11(5)7-8-17-6)14(16)19-10(3)4/h9-12H,7-8H2,1-6H3 |
| InChIKey | JANIZJNSRGGMNJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate?
The IUPAC name of dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate (CID 116500640) is dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate.
What is the SMILES notation for dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate?
The canonical SMILES for dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate is COCCC(C)C(C(=O)OC(C)C)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate?
The InChIKey is JANIZJNSRGGMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5/c1-9(2)18-13(15)12(11(5)7-8-17-6)14(16)19-10(3)4/h9-12H,7-8H2,1-6H3.
What are the key properties of dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate?
dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate has a molecular weight of 274.36 g/mol, XLogP of 2.18, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 2-(4-methoxybutan-2-yl)propanedioate is sourced from PubChem (CID 116500640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).