C9H14OS2 — CID 116504809
3-ethylsulfanyl-1-thiophen-2-ylpropan-1-ol (PubChem CID 116504809) has the molecular formula C9H14OS2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-ethylsulfanyl-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 116504809 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-ethylsulfanyl-1-thiophen-2-ylpropan-1-ol |
| SMILES | CCSCCC(O)c1cccs1 |
| InChI | InChI=1S/C9H14OS2/c1-2-11-7-5-8(10)9-4-3-6-12-9/h3-4,6,8,10H,2,5,7H2,1H3 |
| InChIKey | XIQKLXUREXDDOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|