C14H23NO2S2 — CID 111976091
2-[4-(2-ethylsulfanylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol (PubChem CID 111976091) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-[4-(2-ethylsulfanylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol.
| Compound Name | 2-[4-(2-ethylsulfanylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 111976091 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[4-(2-ethylsulfanylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
| SMILES | CCSCCN1CCOCC1CC(O)c1cccs1 |
| InChI | InChI=1S/C14H23NO2S2/c1-2-18-9-6-15-5-7-17-11-12(15)10-13(16)14-4-3-8-19-14/h3-4,8,12-13,16H,2,5-7,9-11H2,1H3 |
| InChIKey | JYLHUGCMMGYKCQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|