C17H22N2O2S — CID 124734755
(1S)-2-[(3S)-4-(2-pyridin-4-ylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol (PubChem CID 124734755) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (1S)-2-[(3S)-4-(2-pyridin-4-ylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol.
| Compound Name | (1S)-2-[(3S)-4-(2-pyridin-4-ylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 124734755 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (1S)-2-[(3S)-4-(2-pyridin-4-ylethyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
| SMILES | O[C@@H](C[C@H]1COCCN1CCc1ccncc1)c1cccs1 |
| InChI | InChI=1S/C17H22N2O2S/c20-16(17-2-1-11-22-17)12-15-13-21-10-9-19(15)8-5-14-3-6-18-7-4-14/h1-4,6-7,11,15-16,20H,5,8-10,12-13H2/t15-,16-/m0/s1 |
| InChIKey | MTIRBACQKRTCGZ-HOTGVXAUSA-N |
| XLogP | 2.51 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |