C15H16N4O2S — CID 133485968
5-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyrazine-2-carbonitrile (PubChem CID 133485968) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 5-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133485968 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(N2CCOCC2CC(O)c2cccs2)cn1 |
| InChI | InChI=1S/C15H16N4O2S/c16-7-11-8-18-15(9-17-11)19-3-4-21-10-12(19)6-13(20)14-2-1-5-22-14/h1-2,5,8-9,12-13,20H,3-4,6,10H2 |
| InChIKey | DAEHCYNLCRGWQM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |