C15H16BrN3O4S — CID 133347831
2-[4-(3-bromo-5-nitro-2-pyridinyl)morpholin-3-yl]-1-thiophen-2-ylethanol (PubChem CID 133347831) has the molecular formula C15H16BrN3O4S and a molecular weight of 414.28 g/mol. Its IUPAC name is 2-[4-(3-bromo-5-nitro-2-pyridinyl)morpholin-3-yl]-1-thiophen-2-ylethanol.
| Compound Name | 2-[4-(3-bromo-5-nitro-2-pyridinyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 133347831 |
| Molecular Formula | C15H16BrN3O4S |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 2-[4-(3-bromo-5-nitro-2-pyridinyl)morpholin-3-yl]-1-thiophen-2-ylethanol |
| SMILES | O=[N+]([O-])c1cnc(N2CCOCC2CC(O)c2cccs2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrN3O4S/c16-12-6-10(19(21)22)8-17-15(12)18-3-4-23-9-11(18)7-13(20)14-2-1-5-24-14/h1-2,5-6,8,11,13,20H,3-4,7,9H2 |
| InChIKey | SFKNGINNGZIIIZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|