C16H16ClN3O2S — CID 133347824
3-chloro-6-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyridine-2-carbonitrile (PubChem CID 133347824) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 3-chloro-6-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133347824 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-chloro-6-[3-(2-hydroxy-2-thiophen-2-ylethyl)morpholin-4-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(N2CCOCC2CC(O)c2cccs2)ccc1Cl |
| InChI | InChI=1S/C16H16ClN3O2S/c17-12-3-4-16(19-13(12)9-18)20-5-6-22-10-11(20)8-14(21)15-2-1-7-23-15/h1-4,7,11,14,21H,5-6,8,10H2 |
| InChIKey | OUTRGGHITNKAFH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |