C29H51N2O15P — CID 11650550
2-[(2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-methoxycarbonyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxan-2-yl]ethyl-methoxyphosphinic acid;N,N-diethylethanamine (PubChem CID 11650550) has the molecular formula C29H51N2O15P and a molecular weight of 698.70 g/mol. Its IUPAC name is 2-[(2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-methoxycarbonyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxan-2-yl]ethyl-methoxyphosphinic acid;N,N-diethylethanamine.
| Compound Name | 2-[(2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-methoxycarbonyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxan-2-yl]ethyl-methoxyphosphinic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 11650550 |
| Molecular Formula | C29H51N2O15P |
| Molecular Weight | 698.70 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 2-[(2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-methoxycarbonyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxan-2-yl]ethyl-methoxyphosphinic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.COC(=O)[C@]1(CCP(=O)(O)OC)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H36NO15P.C6H15N/c1-12(25)24-19-17(36-14(3)27)10-23(22(30)33-6,8-9-40(31,32)34-7)39-21(19)20(38-16(5)29)18(37-15(4)28)11-35-13(2)26;1-4-7(5-2)6-3/h17-21H,8-11H2,1-7H3,(H,24,25)(H,31,32);4-6H2,1-3H3/t17-,18+,19+,20+,21+,23-;/m0./s1 |
| InChIKey | GYKJXSRIXLZXAC-PSXQWQCASA-N |
| XLogP | 1.12 |
| TPSA | 219.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|