C16H18N2 — CID 116506701
3-[(4-cyclobutylphenyl)methyl]pyridin-2-amine (PubChem CID 116506701) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-[(4-cyclobutylphenyl)methyl]pyridin-2-amine.
| Compound Name | 3-[(4-cyclobutylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 116506701 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 3-[(4-cyclobutylphenyl)methyl]pyridin-2-amine |
| SMILES | Nc1ncccc1Cc1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C16H18N2/c17-16-15(5-2-10-18-16)11-12-6-8-14(9-7-12)13-3-1-4-13/h2,5-10,13H,1,3-4,11H2,(H2,17,18) |
| InChIKey | JYKXXSUUVJRXRJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |