C18H22N4O — CID 72890769
N-[(2-amino-3-pyridinyl)methyl]-4-piperidin-3-ylbenzamide (PubChem CID 72890769) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(2-amino-3-pyridinyl)methyl]-4-piperidin-3-ylbenzamide.
| Compound Name | N-[(2-amino-3-pyridinyl)methyl]-4-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 72890769 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[(2-amino-3-pyridinyl)methyl]-4-piperidin-3-ylbenzamide |
| SMILES | Nc1ncccc1CNC(=O)c1ccc(C2CCCNC2)cc1 |
| InChI | InChI=1S/C18H22N4O/c19-17-16(4-2-10-21-17)12-22-18(23)14-7-5-13(6-8-14)15-3-1-9-20-11-15/h2,4-8,10,15,20H,1,3,9,11-12H2,(H2,19,21)(H,22,23) |
| InChIKey | XCWYHHHHJFYHRH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |