C9H20N2OS — CID 116507879
1,3-diethyl-1-(1-methoxypropan-2-yl)thiourea (PubChem CID 116507879) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is 1,3-diethyl-1-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1,3-diethyl-1-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 116507879 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1,3-diethyl-1-(1-methoxypropan-2-yl)thiourea |
| SMILES | CCNC(=S)N(CC)C(C)COC |
| InChI | InChI=1S/C9H20N2OS/c1-5-10-9(13)11(6-2)8(3)7-12-4/h8H,5-7H2,1-4H3,(H,10,13) |
| InChIKey | BBMWXYSKBZGCJI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|