C6H14N2OS — CID 130891850
1,3-diethyl-1-methoxythiourea (PubChem CID 130891850) has the molecular formula C6H14N2OS and a molecular weight of 162.26 g/mol. Its IUPAC name is 1,3-diethyl-1-methoxythiourea.
| Compound Name | 1,3-diethyl-1-methoxythiourea |
|---|---|
| PubChem CID | 130891850 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1,3-diethyl-1-methoxythiourea |
| SMILES | CCNC(=S)N(CC)OC |
| InChI | InChI=1S/C6H14N2OS/c1-4-7-6(10)8(5-2)9-3/h4-5H2,1-3H3,(H,7,10) |
| InChIKey | GDZGRNKNQMRIOF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|