amino N-ethyl-N-methoxycarbamate

C4H10N2O3 — CID 91118024

IUPACamino N-ethyl-N-methoxycarbamate
SMILESCCN(OC)C(=O)ON
InChIInChI=1S/C4H10N2O3/c1-3-6(8-2)4(7)9-5/h3,5H2,1-2H3
InChIKeyRBXFGZVERPMUHE-UHFFFAOYSA-N
MW134.13 g/mol
LogP-0.12
Rot. Bonds2

About amino N-ethyl-N-methoxycarbamate

amino N-ethyl-N-methoxycarbamate (PubChem CID 91118024) has the molecular formula C4H10N2O3 and a molecular weight of 134.13 g/mol. Its IUPAC name is amino N-ethyl-N-methoxycarbamate.

Molecular Properties

Compound Nameamino N-ethyl-N-methoxycarbamate
PubChem CID91118024
Molecular FormulaC4H10N2O3
Molecular Weight134.13 g/mol
Exact Mass134.07
IUPAC Nameamino N-ethyl-N-methoxycarbamate
SMILESCCN(OC)C(=O)ON
InChIInChI=1S/C4H10N2O3/c1-3-6(8-2)4(7)9-5/h3,5H2,1-2H3
InChIKeyRBXFGZVERPMUHE-UHFFFAOYSA-N
XLogP-0.12
TPSA64.79 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.13
LogP ≤ 5-0.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino N-ethyl-N-methoxycarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(Ethyl-methoxy-methylazaniumyl)formate
CID 19024131
Ethyl(methoxy)carbamic acid
CID 20532492
Aminooxy(ethyl)carbamic acid
CID 87523078
methyl N-ethyl-N-hydroxycarbamate
CID 88073677
amino N-ethyl-N-methylcarbamate
CID 89157938
methyl N-carbamoyloxy-N-ethylcarbamate
CID 89853626
methyl N-ethyl-N-methoxycarbamate
CID 142794399
dimethylamino N-ethoxy-N-ethylcarbamate
CID 174467424
amino N-butyl-N-hydroxycarbamate
CID 174824959
N-ethyl-N-[ethyl(formyl)amino]oxyformamide
CID 175272826
N-ethoxy-N-ethylcarbamate
CID 23617165
CID 102286941
CID 102286941

Frequently Asked Questions

What is the IUPAC name of amino N-ethyl-N-methoxycarbamate?
The IUPAC name of amino N-ethyl-N-methoxycarbamate (CID 91118024) is amino N-ethyl-N-methoxycarbamate.
What is the SMILES notation for amino N-ethyl-N-methoxycarbamate?
The canonical SMILES for amino N-ethyl-N-methoxycarbamate is CCN(OC)C(=O)ON.
What is the InChIKey of amino N-ethyl-N-methoxycarbamate?
The InChIKey is RBXFGZVERPMUHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O3/c1-3-6(8-2)4(7)9-5/h3,5H2,1-2H3.
What are the key properties of amino N-ethyl-N-methoxycarbamate?
amino N-ethyl-N-methoxycarbamate has a molecular weight of 134.13 g/mol, XLogP of -0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-ethyl-N-methoxycarbamate is sourced from PubChem (CID 91118024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).