C8H14F2N2S — CID 116509660
1-cyclopentyl-3-(2,2-difluoroethyl)thiourea (PubChem CID 116509660) has the molecular formula C8H14F2N2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,2-difluoroethyl)thiourea.
| Compound Name | 1-cyclopentyl-3-(2,2-difluoroethyl)thiourea |
|---|---|
| PubChem CID | 116509660 |
| Molecular Formula | C8H14F2N2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-cyclopentyl-3-(2,2-difluoroethyl)thiourea |
| SMILES | FC(F)CNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C8H14F2N2S/c9-7(10)5-11-8(13)12-6-3-1-2-4-6/h6-7H,1-5H2,(H2,11,12,13) |
| InChIKey | BQZAPULAVXNAQI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|