C12H20N4O2S — CID 116512240
1-amino-2-(2-methylpropyl)-3-(4-methylsulfonylphenyl)guanidine (PubChem CID 116512240) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-amino-2-(2-methylpropyl)-3-(4-methylsulfonylphenyl)guanidine.
| Compound Name | 1-amino-2-(2-methylpropyl)-3-(4-methylsulfonylphenyl)guanidine |
|---|---|
| PubChem CID | 116512240 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-amino-2-(2-methylpropyl)-3-(4-methylsulfonylphenyl)guanidine |
| SMILES | CC(C)C/N=C(\NN)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N4O2S/c1-9(2)8-14-12(16-13)15-10-4-6-11(7-5-10)19(3,17)18/h4-7,9H,8,13H2,1-3H3,(H2,14,15,16) |
| InChIKey | KLCAUUCGDXOOQT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|