C14H22N4S — CID 116512879
N-amino-N'-cyclohexyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboximidamide (PubChem CID 116512879) has the molecular formula C14H22N4S and a molecular weight of 278.42 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboximidamide.
| Compound Name | N-amino-N'-cyclohexyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 116512879 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-amino-N'-cyclohexyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboximidamide |
| SMILES | NN/C(=N\C1CCCCC1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H22N4S/c15-17-14(16-12-4-2-1-3-5-12)18-8-6-13-11(10-18)7-9-19-13/h7,9,12H,1-6,8,10,15H2,(H,16,17) |
| InChIKey | ADMLKOJLZZQIKZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|