C12H16N4 — CID 116513680
N-amino-N'-cyclopropyl-1,3-dihydroisoindole-2-carboximidamide (PubChem CID 116513680) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-amino-N'-cyclopropyl-1,3-dihydroisoindole-2-carboximidamide.
| Compound Name | N-amino-N'-cyclopropyl-1,3-dihydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 116513680 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-amino-N'-cyclopropyl-1,3-dihydroisoindole-2-carboximidamide |
| SMILES | NN/C(=N\C1CC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16N4/c13-15-12(14-11-5-6-11)16-7-9-3-1-2-4-10(9)8-16/h1-4,11H,5-8,13H2,(H,14,15) |
| InChIKey | YXOJCWMLAHHSLJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|