C16H24N4 — CID 163642773
N'-(4-aminocyclohexyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 163642773) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N'-(4-aminocyclohexyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-(4-aminocyclohexyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 163642773 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N'-(4-aminocyclohexyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | N/C(=N\C1CCC(N)CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H24N4/c17-14-5-7-15(8-6-14)19-16(18)20-10-9-12-3-1-2-4-13(12)11-20/h1-4,14-15H,5-11,17H2,(H2,18,19) |
| InChIKey | IFRLISMRGHJOSJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|