C23H39N3O6 — CID 58103981
N'-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 58103981) has the molecular formula C23H39N3O6 and a molecular weight of 453.58 g/mol. Its IUPAC name is N'-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 58103981 |
| Molecular Formula | C23H39N3O6 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N'-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | COCCOCCOCCOCCOCCOCC/N=C(\N)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H39N3O6/c1-27-10-11-29-14-15-31-18-19-32-17-16-30-13-12-28-9-7-25-23(24)26-8-6-21-4-2-3-5-22(21)20-26/h2-5H,6-20H2,1H3,(H2,24,25) |
| InChIKey | XHAPIMRCJYZRDF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|