C13H19N3S — CID 79206755
N-amino-N'-cyclopentyl-2-phenylsulfanylethanimidamide (PubChem CID 79206755) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-2-phenylsulfanylethanimidamide.
| Compound Name | N-amino-N'-cyclopentyl-2-phenylsulfanylethanimidamide |
|---|---|
| PubChem CID | 79206755 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-amino-N'-cyclopentyl-2-phenylsulfanylethanimidamide |
| SMILES | NN/C(CSc1ccccc1)=N\C1CCCC1 |
| InChI | InChI=1S/C13H19N3S/c14-16-13(15-11-6-4-5-7-11)10-17-12-8-2-1-3-9-12/h1-3,8-9,11H,4-7,10,14H2,(H,15,16) |
| InChIKey | IUBUIIKLGWULFW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|