C14H16O4 — CID 11651710
methyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 11651710) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 11651710 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | methyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | C#CC1(C#C)O[C@]2(CO)CCC[C@@]1(C(=O)OC)C2 |
| InChI | InChI=1S/C14H16O4/c1-4-14(5-2)13(11(16)17-3)8-6-7-12(9-13,10-15)18-14/h1-2,15H,6-10H2,3H3/t12-,13+/m1/s1 |
| InChIKey | JMHFBAYVVOGCGH-OLZOCXBDSA-N |
| XLogP | 0.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|