C16H26O4 — CID 139120346
(1R,2'R,5R,6'R)-5-(hydroxymethyl)-2',6'-dimethylspiro[6-oxabicyclo[3.2.1]octane-7,1'-cyclohexane]-1-carboxylic acid (PubChem CID 139120346) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2'R,5R,6'R)-5-(hydroxymethyl)-2',6'-dimethylspiro[6-oxabicyclo[3.2.1]octane-7,1'-cyclohexane]-1-carboxylic acid.
| Compound Name | (1R,2'R,5R,6'R)-5-(hydroxymethyl)-2',6'-dimethylspiro[6-oxabicyclo[3.2.1]octane-7,1'-cyclohexane]-1-carboxylic acid |
|---|---|
| PubChem CID | 139120346 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1R,2'R,5R,6'R)-5-(hydroxymethyl)-2',6'-dimethylspiro[6-oxabicyclo[3.2.1]octane-7,1'-cyclohexane]-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[C@@H](C)C12O[C@]1(CO)CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H26O4/c1-11-5-3-6-12(2)16(11)15(13(18)19)8-4-7-14(9-15,10-17)20-16/h11-12,17H,3-10H2,1-2H3,(H,18,19)/t11-,12-,14-,15+/m1/s1 |
| InChIKey | CSKIBAMGNPXINQ-GBOPCIDUSA-N |
| XLogP | 2.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |