C19H30O5 — CID 135035536
(1R,4S,6R,7S,9R,10S,13S)-6,7,16-trihydroxy-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one (PubChem CID 135035536) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (1R,4S,6R,7S,9R,10S,13S)-6,7,16-trihydroxy-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one.
| Compound Name | (1R,4S,6R,7S,9R,10S,13S)-6,7,16-trihydroxy-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
|---|---|
| PubChem CID | 135035536 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R,4S,6R,7S,9R,10S,13S)-6,7,16-trihydroxy-5,5,9,13-tetramethyl-15-oxatetracyclo[11.2.1.01,10.04,9]hexadecan-14-one |
| SMILES | CC1(C)[C@H]2CC[C@@]34OC(=O)[C@@](C)(CC[C@H]3[C@]2(C)C[C@H](O)[C@@H]1O)C4O |
| InChI | InChI=1S/C19H30O5/c1-16(2)11-6-8-19-12(18(11,4)9-10(20)13(16)21)5-7-17(3,14(19)22)15(23)24-19/h10-14,20-22H,5-9H2,1-4H3/t10-,11+,12-,13-,14?,17-,18+,19+/m0/s1 |
| InChIKey | IBFNGDCMVFFJMH-KAVYNQGSSA-N |
| XLogP | 1.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |