C9H7Cl2N3S2 — CID 116519698
5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole (PubChem CID 116519698) has the molecular formula C9H7Cl2N3S2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 116519698 |
| Molecular Formula | C9H7Cl2N3S2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | 5-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(SCc2cnc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C9H7Cl2N3S2/c1-5-13-9(16-14-5)15-4-6-3-12-8(11)2-7(6)10/h2-3H,4H2,1H3 |
| InChIKey | CTGUBQXMWSSMEY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|