C16H17FN2O — CID 116519991
N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-6-fluoropyridin-2-amine (PubChem CID 116519991) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116519991 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[(2,2-dimethyl-3H-1-benzofuran-7-yl)methyl]-6-fluoropyridin-2-amine |
| SMILES | CC1(C)Cc2cccc(CNc3cccc(F)n3)c2O1 |
| InChI | InChI=1S/C16H17FN2O/c1-16(2)9-11-5-3-6-12(15(11)20-16)10-18-14-8-4-7-13(17)19-14/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | ACDMWBKOGZOBBE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|