C14H11N3O4 — CID 116520237
4-(4-methoxy-1H-indole-3-carbonyl)-1H-imidazole-5-carboxylic acid (PubChem CID 116520237) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-(4-methoxy-1H-indole-3-carbonyl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 4-(4-methoxy-1H-indole-3-carbonyl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 116520237 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-(4-methoxy-1H-indole-3-carbonyl)-1H-imidazole-5-carboxylic acid |
| SMILES | COc1cccc2[nH]cc(C(=O)c3nc[nH]c3C(=O)O)c12 |
| InChI | InChI=1S/C14H11N3O4/c1-21-9-4-2-3-8-10(9)7(5-15-8)13(18)11-12(14(19)20)17-6-16-11/h2-6,15H,1H3,(H,16,17)(H,19,20) |
| InChIKey | BJVHBZXIDIZUJM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |