C13H23NO — CID 116521533
N-[(5,5-dimethyloxolan-2-yl)methyl]cyclohex-3-en-1-amine (PubChem CID 116521533) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-2-yl)methyl]cyclohex-3-en-1-amine.
| Compound Name | N-[(5,5-dimethyloxolan-2-yl)methyl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 116521533 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[(5,5-dimethyloxolan-2-yl)methyl]cyclohex-3-en-1-amine |
| SMILES | CC1(C)CCC(CNC2CC=CCC2)O1 |
| InChI | InChI=1S/C13H23NO/c1-13(2)9-8-12(15-13)10-14-11-6-4-3-5-7-11/h3-4,11-12,14H,5-10H2,1-2H3 |
| InChIKey | FZPSNBSIERWODC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|