C12H23NO2 — CID 116521230
N-[(5,5-dimethyloxolan-2-yl)methyl]oxan-4-amine (PubChem CID 116521230) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-2-yl)methyl]oxan-4-amine.
| Compound Name | N-[(5,5-dimethyloxolan-2-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 116521230 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[(5,5-dimethyloxolan-2-yl)methyl]oxan-4-amine |
| SMILES | CC1(C)CCC(CNC2CCOCC2)O1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2)6-3-11(15-12)9-13-10-4-7-14-8-5-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | UZXFNTNESNXWOH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |